![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| theme.ppt | 2002-10-04 14:14 | 64K | |
| setting and metaphor.ppt | 2002-09-04 13:13 | 56K | |
| questionsbobandchina.ppt | 2002-08-28 20:20 | 58K | |
| metaphor and metonomy.ppt | 2002-10-01 14:33 | 70K | |
| m butterfly.ppt | 2002-12-02 15:41 | 885 | |
| introdrama.ppt | 2002-10-29 18:45 | 92K | |
| form and structure.ppt | 2002-09-25 14:34 | 37K | |
| elements of drama.ppt | 2002-11-01 18:23 | 72K | |
| earnest.ppt | 2002-11-18 16:19 | 91K | |
| culler5.ppt | 2002-10-22 22:46 | 74K | |
| Thesis Statements.ppt | 2002-09-12 15:46 | 63K | |
| The Tempest.ppt | 2002-11-11 15:32 | 77K | |
| Shortcut to 150.lnk | 2002-09-13 14:52 | 279 | |
| Sample Test Questions.ppt | 2002-12-02 08:41 | 15K | |
| Plot and Character.ppt | 2002-08-27 14:03 | 28K | |
| Plot.ppt | 2002-08-26 14:39 | 113K | |
| Performative Language.ppt | 2002-11-04 01:48 | 100K | |
| Paper Assignment.ppt | 2002-09-10 16:21 | 52K | |
| M. Butterfly.ppt | 2002-12-02 15:45 | 37K | |
| Intro to poetry..ppt | 2002-09-23 13:53 | 36K | |
| Harper.ppt | 2002-10-08 21:16 | 58K | |
| Diction.ppt | 2002-10-01 15:22 | 61K | |
| Culler_s Chapter 4.ppt | 2002-10-07 14:04 | 70K | |
| Culler 7.ppt | 2002-11-04 15:53 | 46K | |
| 150intro.ppt | 2002-08-19 12:38 | 59K | |
| 150cullerchapter2.ppt | 2002-08-21 13:50 | 47K | |